Drugs Information: Abacavir
Basic Information
|
||
| ID | DDInter1 | |
| Drug Type | small molecule | |
| Molecular Formula | C14H18N6O | |
| Molecular Weight | 286.339 | |
| Description | Abacavir is an antiviral nucleoside reverse transcriptase inhibitor used in combination with other antiretrovirals for the treatment of HIV. | |
| ATC Classification | J05AR13 J05AR02 J05AR04 J05AF06 | |
| IUPAC Name | [(1S,4R)-4-[2-Amino-6-(Cyclopropylamino)-9H-Purin-9-Yl]Cyclopent-2-En-1-Yl]Methanol | |
| InChI | Inchi=1S/C14H18N6O/C15-14-18-12(17-9-2-3-9)11-13(19-14)20(7-16-11)10-4-1-8(5-10)6-21/H1,4,7-10,21H,2-3,5-6H2,(H3,15,17,18,19)/T8-,10+/M1/S1 | |
| InChI Key | MCGSCOLBFJQGHM-SCZZXKLOSA-N | |
| Canonical SMILES | NC1=NC2=C(N=CN2[C@@H]2C[C@H](CO)C=C2)C(NC2CC2)=N1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Abacavir
| Severity level | ID | Name | Mechanism | Detail |
|---|