Drugs Information: Ixazomib
Basic Information
|
||
| ID | DDInter1002 | |
| Drug Type | small molecule | |
| Molecular Formula | C14H19Bcl2N2O4 | |
| Molecular Weight | 361.033 | |
| Description | Ixazomib is a monoclonal antibody used with other medications to treat multiple myeloma in patients who have received one other therapy already. | |
| ATC Classification | L01XX50 | |
| IUPAC Name | [(1R)-1-{2-[(2,5-Dichlorophenyl)Formamido]Acetamido}-3-Methylbutyl]Boronic Acid | |
| InChI | Inchi=1S/C14H19Bcl2N2O4/C1-8(2)5-12(15(22)23)19-13(20)7-18-14(21)10-6-9(16)3-4-11(10)17/H3-4,6,8,12,22-23H,5,7H2,1-2H3,(H,18,21)(H,19,20)/T12-/M0/S1 | |
| InChI Key | MXAYKZJJDUDWDS-LBPRGKRZSA-N | |
| Canonical SMILES | CC(C)C[C@H](NC(=O)CNC(=O)C1=CC(Cl)=CC=C1Cl)B(O)O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Ixazomib
| Severity level | ID | Name | Mechanism | Detail |
|---|