Drugs Information: Lactic acid
Basic Information
|
||
| ID | DDInter1015 | |
| Drug Type | small molecule | |
| Molecular Formula | C3H6O3 | |
| Molecular Weight | 90.078 | |
| Description | Lactic acid is an emollient and keratolytic used agent in various cosmetic products and used as an additive in various pharmaceutical products for its antibacterial properties. | |
| ATC Classification | G01AD01 | |
| IUPAC Name | 2-Hydroxypropanoic Acid | |
| InChI | Inchi=1S/C3H6O3/C1-2(4)3(5)6/H2,4H,1H3,(H,5,6) | |
| InChI Key | JVTAAEKCZFNVCJ-UHFFFAOYSA-N | |
| Canonical SMILES | CC(O)C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Lactic acid
| Severity level | ID | Name | Mechanism | Detail |
|---|