Drugs Information: Larotrectinib
Basic Information
|
||
| ID | DDInter1026 | |
| Drug Type | small molecule | |
| Molecular Formula | C21H22F2N6O2 | |
| Molecular Weight | 428.443 | |
| Description | Larotrectinib is a kinase inhibitor used to treat solid tumors with neurotrophic receptor tyrosine kinase gene fusion, are metastatic, high risk for surgery, or have no alternative treatments. | |
| ATC Classification | L01XE53 | |
| IUPAC Name | (3S)-N-{5-[(2R)-2-(2,5-Difluorophenyl)Pyrrolidin-1-Yl]Pyrazolo[1,5-A]Pyrimidin-3-Yl}-3-Hydroxypyrrolidine-1-Carboxamide | |
| InChI | Inchi=1S/C21H22F2N6O2/C22-13-3-4-16(23)15(10-13)18-2-1-7-28(18)19-6-9-29-20(26-19)17(11-24-29)25-21(31)27-8-5-14(30)12-27/H3-4,6,9-11,14,18,30H,1-2,5,7-8,12H2,(H,25,31)/T14-,18+/M0/S1 | |
| InChI Key | NYNZQNWKBKUAII-KBXCAEBGSA-N | |
| Canonical SMILES | O[C@H]1CCN(C1)C(=O)NC1=C2N=C(C=CN2N=C1)N1CCC[C@@H]1C1=C(F)C=CC(F)=C1 | |
| Useful Links | DrugBank ChEMBL | |
Interactions with Larotrectinib
| Severity level | ID | Name | Mechanism | Detail |
|---|