Drugs Information: Latanoprostene bunod (ophthalmic)
Basic Information
|
||
| ID | DDInter1030 | |
| Drug Type | small molecule | |
| Molecular Formula | C27H41No8 | |
| Molecular Weight | 507.624 | |
| Description | Latanoprostene bunod is a prostaglandin analog used to reduce ocular hypertension or treat open-angle glaucoma. | |
| ATC Classification | S01EE06 | |
| IUPAC Name | 4-(Nitrooxy)Butyl (5Z)-7-[(1R,2R,3R,5S)-3,5-Dihydroxy-2-[(3R)-3-Hydroxy-5-Phenylpentyl]Cyclopentyl]Hept-5-Enoate | |
| InChI | Inchi=1S/C27H41No8/C29-22(15-14-21-10-4-3-5-11-21)16-17-24-23(25(30)20-26(24)31)12-6-1-2-7-13-27(32)35-18-8-9-19-36-28(33)34/H1,3-6,10-11,22-26,29-31H,2,7-9,12-20H2/B6-1-/T22-,23+,24+,25-,26+/M0/S1 | |
| InChI Key | LOVMMUBRQUFEAH-UIEAZXIASA-N | |
| Canonical SMILES | O[C@H](CC[C@H]1[C@H](O)C[C@H](O)[C@@H]1C\C=C/CCCC(=O)OCCCCO[N+]([O-])=O)CCC1=CC=CC=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Latanoprostene bunod (ophthalmic)
| Severity level | ID | Name | Mechanism | Detail |
|---|