Drugs Information: Lemborexant
Basic Information
|
||
| ID | DDInter1034 | |
| Drug Type | small molecule | |
| Molecular Formula | C22H20F2N4O2 | |
| Molecular Weight | 410.424 | |
| Description | Lemborexant is a dual orexin antagonist indicated for the treatment of sleep-onset and/or sleep maintenance insomnia. | |
| ATC Classification | - | |
| IUPAC Name | (1R,2S)-2-{[(2,4-Dimethylpyrimidin-5-Yl)Oxy]Methyl}-2-(3-Fluorophenyl)-N-(5-Fluoropyridin-2-Yl)Cyclopropane-1-Carboxamide | |
| InChI | Inchi=1S/C22H20F2N4O2/C1-13-19(11-25-14(2)27-13)30-12-22(15-4-3-5-16(23)8-15)9-18(22)21(29)28-20-7-6-17(24)10-26-20/H3-8,10-11,18H,9,12H2,1-2H3,(H,26,28,29)/T18-,22+/M0/S1 | |
| InChI Key | MUGXRYIUWFITCP-PGRDOPGGSA-N | |
| Canonical SMILES | CC1=NC=C(OC[C@]2(C[C@H]2C(=O)NC2=NC=C(F)C=C2)C2=CC=CC(F)=C2)C(C)=N1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Lemborexant
| Severity level | ID | Name | Mechanism | Detail |
|---|