Drugs Information: Letermovir
Basic Information
|
||
| ID | DDInter1039 | |
| Drug Type | small molecule | |
| Molecular Formula | C29H28F4N4O4 | |
| Molecular Weight | 572.559 | |
| Description | Letermovir is an antiviral medication used to treat CMV infections and disease in adult CMV-seropositive recipients of an allogeneic hematopoietic stem cell transplant (HSCT). | |
| ATC Classification | J05AX18 | |
| IUPAC Name | 2-[(4S)-8-Fluoro-3-[2-Methoxy-5-(Trifluoromethyl)Phenyl]-2-[4-(3-Methoxyphenyl)Piperazin-1-Yl]-3,4-Dihydroquinazolin-4-Yl]Acetic | |
| InChI | Inchi=1S/C29H28F4N4O4/C1-40-20-6-3-5-19(16-20)35-11-13-36(14-12-35)28-34-27-21(7-4-8-22(27)30)23(17-26(38)39)37(28)24-15-18(29(31,32)33)9-10-25(24)41-2/H3-10,15-16,23H,11-14,17H2,1-2H3,(H,38,39)/T23-/M0/S1 | |
| InChI Key | FWYSMLBETOMXAG-QHCPKHFHSA-N | |
| Canonical SMILES | COC1=CC=CC(=C1)N1CCN(CC1)C1=NC2=C(C=CC=C2F)[C@H](CC(O)=O)N1C1=CC(=CC=C1OC)C(F)(F)F | |
| Useful Links | DrugBank ChEMBL | |
Interactions with Letermovir
| Severity level | ID | Name | Mechanism | Detail |
|---|