Drugs Information: Leucovorin
Basic Information
|
||
| ID | DDInter1041 | |
| Drug Type | small molecule | |
| Molecular Formula | C20H23N7O7 | |
| Molecular Weight | 473.446 | |
| Description | Leucovorin is a folate analog used to treat the toxic effects of methotrexate and other folate antagonists, to treat megaloblastic anemia, and to provide palliative treatment of colorectal cancer. | |
| ATC Classification | V03AF06 V03AF03 | |
| IUPAC Name | (2S)-2-[(4-{[(2-Amino-5-Formyl-4-Oxo-3,4,5,6,7,8-Hexahydropteridin-6-Yl)Methyl]Amino}Phenyl)Formamido]Pentanedioic Acid | |
| InChI | Inchi=1S/C20H23N7O7/C21-20-25-16-15(18(32)26-20)27(9-28)12(8-23-16)7-22-11-3-1-10(2-4-11)17(31)24-13(19(33)34)5-6-14(29)30/H1-4,9,12-13,22H,5-8H2,(H,24,31)(H,29,30)(H,33,34)(H4,21,23,25,26,32)/T12?,13-/M0/S1 | |
| InChI Key | VVIAGPKUTFNRDU-ABLWVSNPSA-N | |
| Canonical SMILES | [H]C(=O)N1C(CNC2=CC=C(C=C2)C(=O)N[C@@H](CCC(O)=O)C(O)=O)CNC2=C1C(=O)NC(N)=N2 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Leucovorin
| Severity level | ID | Name | Mechanism | Detail |
|---|