Drugs Information: Levoleucovorin
Basic Information
|
||
| ID | DDInter1056 | |
| Drug Type | small molecule | |
| Molecular Formula | C20H23N7O7 | |
| Molecular Weight | 473.446 | |
| Description | Levoleucovorin is a folate analog used after high dose methotrexate for osteosarcoma, to reduce the toxic effects of folate analogs, and with 5-fluorouracil in palliative treatment of advanced metastatic colorectal cancer. | |
| ATC Classification | V03AF10 V03AF04 | |
| IUPAC Name | (2S)-2-{[4-({[(6S)-2-Amino-5-Formyl-4-Oxo-1,4,5,6,7,8-Hexahydropteridin-6-Yl]Methyl}Amino)Phenyl]Formamido}Pentanedioic Acid | |
| InChI | Inchi=1S/C20H23N7O7/C21-20-25-16-15(18(32)26-20)27(9-28)12(8-23-16)7-22-11-3-1-10(2-4-11)17(31)24-13(19(33)34)5-6-14(29)30/H1-4,9,12-13,22H,5-8H2,(H,24,31)(H,29,30)(H,33,34)(H4,21,23,25,26,32)/T12-,13-/M0/S1 | |
| InChI Key | VVIAGPKUTFNRDU-STQMWFEESA-N | |
| Canonical SMILES | NC1=NC(=O)C2=C(NC[C@H](CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(O)=O)C(O)=O)N2C=O)N1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Levoleucovorin
| Severity level | ID | Name | Mechanism | Detail |
|---|