Drugs Information: Apalutamide
Basic Information
|
||
| ID | DDInter107 | |
| Drug Type | small molecule | |
| Molecular Formula | C21H15F4N5O2S | |
| Molecular Weight | 477.442 | |
| Description | Apalutamide is an androgen receptor inhibitor used to treat non metastatic, castration resistant prostate cancer. | |
| ATC Classification | L02BB05 | |
| IUPAC Name | 4-{7-[6-Cyano-5-(Trifluoromethyl)Pyridin-3-Yl]-8-Oxo-6-Sulfanylidene-5,7-Diazaspiro[3.4]Octan-5-Yl}-2-Fluoro-N-Methylbenzamide | |
| InChI | Inchi=1S/C21H15F4N5O2S/C1-27-17(31)13-4-3-11(8-15(13)22)30-19(33)29(18(32)20(30)5-2-6-20)12-7-14(21(23,24)25)16(9-26)28-10-12/H3-4,7-8,10H,2,5-6H2,1H3,(H,27,31) | |
| InChI Key | HJBWBFZLDZWPHF-UHFFFAOYSA-N | |
| Canonical SMILES | CNC(=O)C1=CC=C(C=C1F)N1C(=S)N(C(=O)C11CCC1)C1=CC(=C(N=C1)C#N)C(F)(F)F | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Apalutamide
| Severity level | ID | Name | Mechanism | Detail |
|---|