Drugs Information: Linezolid
Basic Information
|
|
||
| ID | DDInter1073 | |
| Drug Type | small molecule | |
| Molecular Formula | C16H20Fn3O4 | |
| Molecular Weight | 337.351 | |
| Description | Linezolid is an oxazolidinone antibiotic used to treat infections by susceptible strains of aerobic Gram-positive bacteria. | |
| ATC Classification | J01XX08 | |
| IUPAC Name | N-{[(5S)-3-[3-Fluoro-4-(Morpholin-4-Yl)Phenyl]-2-Oxo-1,3-Oxazolidin-5-Yl]Methyl}Acetamide | |
| InChI | Inchi=1S/C16H20Fn3O4/C1-11(21)18-9-13-10-20(16(22)24-13)12-2-3-15(14(17)8-12)19-4-6-23-7-5-19/H2-3,8,13H,4-7,9-10H2,1H3,(H,18,21)/T13-/M0/S1 | |
| InChI Key | TYZROVQLWOKYKF-ZDUSSCGKSA-N | |
| Canonical SMILES | CC(=O)NC[C@H]1CN(C(=O)O1)C1=CC(F)=C(C=C1)N1CCOCC1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Linezolid
| Severity level | ID | Name | Mechanism | Detail |
|---|