Drugs Information: Lisdexamfetamine
Basic Information
|
||
| ID | DDInter1078 | |
| Drug Type | small molecule | |
| Molecular Formula | C15H25N3O | |
| Molecular Weight | 263.385 | |
| Description | Lisdexamfetamine is a central nervous system (CNS) stimulant used to treat attention deficit hyperactivity disorder (ADHD) and moderate to severe eating disorders. | |
| ATC Classification | N06BA12 | |
| IUPAC Name | (2S)-2,6-Diamino-N-[(2S)-1-Phenylpropan-2-Yl]Hexanamide | |
| InChI | Inchi=1S/C15H25N3O/C1-12(11-13-7-3-2-4-8-13)18-15(19)14(17)9-5-6-10-16/H2-4,7-8,12,14H,5-6,9-11,16-17H2,1H3,(H,18,19)/T12-,14-/M0/S1 | |
| InChI Key | VOBHXZCDAVEXEY-JSGCOSHPSA-N | |
| Canonical SMILES | C[C@@H](CC1=CC=CC=C1)NC(=O)[C@@H](N)CCCCN | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Lisdexamfetamine
| Severity level | ID | Name | Mechanism | Detail |
|---|