Drugs Information: Lisinopril
Basic Information
|
|
||
| ID | DDInter1079 | |
| Drug Type | small molecule | |
| Molecular Formula | C21H31N3O5 | |
| Molecular Weight | 405.495 | |
| Description | Lisinopril is an ACE inhibitor used to treat hypertension, heart failure, and acute myocardial infarction. | |
| ATC Classification | C09BA03 C10BX07 C09AA03 C09BB03 | |
| IUPAC Name | (2S)-1-[(2S)-6-Amino-2-{[(1S)-1-Carboxy-3-Phenylpropyl]Amino}Hexanoyl]Pyrrolidine-2-Carboxylic Acid | |
| InChI | Inchi=1S/C21H31N3O5/C22-13-5-4-9-16(19(25)24-14-6-10-18(24)21(28)29)23-17(20(26)27)12-11-15-7-2-1-3-8-15/H1-3,7-8,16-18,23H,4-6,9-14,22H2,(H,26,27)(H,28,29)/T16-,17-,18-/M0/S1 | |
| InChI Key | RLAWWYSOJDYHDC-BZSNNMDCSA-N | |
| Canonical SMILES | NCCCC[C@H](N[C@@H](CCC1=CC=CC=C1)C(O)=O)C(=O)N1CCC[C@H]1C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Lisinopril
| Severity level | ID | Name | Mechanism | Detail |
|---|