Drugs Information: Lomitapide
Basic Information
|
||
| ID | DDInter1085 | |
| Drug Type | small molecule | |
| Molecular Formula | C39H37F6N3O2 | |
| Molecular Weight | 693.732 | |
| Description | Lomitapide is a microsomal triglyceride transfer protein inhibitor used to lower cholesterol associated with homozygous familial hypercholesterolemia (HoFH), reducing risk of cardiovascular events such as myocardial infarction and stroke. | |
| ATC Classification | C10AX12 | |
| IUPAC Name | N-(2,2,2-Trifluoroethyl)-9-[4-(4-{2-[4-(Trifluoromethyl)Phenyl]Benzamido}Piperidin-1-Yl)Butyl]-9H-Fluorene-9-Carboxamide | |
| InChI | Inchi=1S/C39H37F6N3O2/C40-38(41,42)25-46-36(50)37(33-13-5-3-10-30(33)31-11-4-6-14-34(31)37)21-7-8-22-48-23-19-28(20-24-48)47-35(49)32-12-2-1-9-29(32)26-15-17-27(18-16-26)39(43,44)45/H1-6,9-18,28H,7-8,19-25H2,(H,46,50)(H,47,49) | |
| InChI Key | MBBCVAKAJPKAKM-UHFFFAOYSA-N | |
| Canonical SMILES | FC(F)(F)CNC(=O)C1(CCCCN2CCC(CC2)NC(=O)C2=C(C=CC=C2)C2=CC=C(C=C2)C(F)(F)F)C2=CC=CC=C2C2=CC=CC=C12 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Lomitapide
| Severity level | ID | Name | Mechanism | Detail |
|---|