Drugs Information: Loracarbef
Basic Information
|
||
| ID | DDInter1090 | |
| Drug Type | small molecule | |
| Molecular Formula | C16H16Cln3O4 | |
| Molecular Weight | 349.774 | |
| Description | Loracarbef is a carbacephem antibiotic sometimes grouped together with the second-generation cephalosporin antibiotics. It is marketed under the trade name Lorabid. | |
| ATC Classification | J01DC08 | |
| IUPAC Name | (6R,7S)-7-[(2R)-2-Amino-2-Phenylacetamido]-3-Chloro-8-Oxo-1-Azabicyclo[4.2.0]Oct-2-Ene-2-Carboxylic Acid | |
| InChI | Inchi=1S/C16H16Cln3O4/C17-9-6-7-10-12(15(22)20(10)13(9)16(23)24)19-14(21)11(18)8-4-2-1-3-5-8/H1-5,10-12H,6-7,18H2,(H,19,21)(H,23,24)/T10-,11-,12+/M1/S1 | |
| InChI Key | JAPHQRWPEGVNBT-UTUOFQBUSA-N | |
| Canonical SMILES | N[C@@H](C(=O)N[C@H]1[C@H]2CCC(Cl)=C(N2C1=O)C(O)=O)C1=CC=CC=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Loracarbef
| Severity level | ID | Name | Mechanism | Detail |
|---|