Drugs Information: Losartan
Basic Information
|
||
| ID | DDInter1095 | |
| Drug Type | small molecule | |
| Molecular Formula | C22H23Cln6O | |
| Molecular Weight | 422.920 | |
| Description | Losartan is an angiotensin receptor blocker used to treat hypertension and diabetic nephropathy, and is used to reduce the risk of stroke. | |
| ATC Classification | C09CA01 C09DA01 C09DB06 | |
| IUPAC Name | [2-Butyl-4-Chloro-1-({4-[2-(2H-1,2,3,4-Tetrazol-5-Yl)Phenyl]Phenyl}Methyl)-1H-Imidazol-5-Yl]Methanol | |
| InChI | Inchi=1S/C22H23Cln6O/C1-2-3-8-20-24-21(23)19(14-30)29(20)13-15-9-11-16(12-10-15)17-6-4-5-7-18(17)22-25-27-28-26-22/H4-7,9-12,30H,2-3,8,13-14H2,1H3,(H,25,26,27,28) | |
| InChI Key | PSIFNNKUMBGKDQ-UHFFFAOYSA-N | |
| Canonical SMILES | CCCCC1=NC(Cl)=C(CO)N1CC1=CC=C(C=C1)C1=CC=CC=C1C1=NNN=N1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Losartan
| Severity level | ID | Name | Mechanism | Detail |
|---|