Drugs Information: Lubiprostone
Basic Information
|
||
| ID | DDInter1100 | |
| Drug Type | small molecule | |
| Molecular Formula | C20H32F2O5 | |
| Molecular Weight | 390.467 | |
| Description | Lubiprostone is a prostaglandin derivative used to treat constipation caused by irritable bowel syndrome and opioid-use. | |
| ATC Classification | A06AX03 | |
| IUPAC Name | 7-[(2R,4Ar,5R,7Ar)-2-(1,1-Difluoropentyl)-2-Hydroxy-6-Oxo-Octahydrocyclopenta[B]Pyran-5-Yl]Heptanoic Acid | |
| InChI | Inchi=1S/C20H32F2O5/C1-2-3-11-19(21,22)20(26)12-10-15-14(16(23)13-17(15)27-20)8-6-4-5-7-9-18(24)25/H14-15,17,26H,2-13H2,1H3,(H,24,25)/T14-,15-,17-,20-/M1/S1 | |
| InChI Key | WGFOBBZOWHGYQH-MXHNKVEKSA-N | |
| Canonical SMILES | [H][C@@]12CC(=O)[C@H](CCCCCCC(O)=O)[C@@]1([H])CC[C@@](O)(O2)C(F)(F)CCCC | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Lubiprostone
| Severity level | ID | Name | Mechanism | Detail |
|---|