Drugs Information: Macitentan
Basic Information
|
||
| ID | DDInter1111 | |
| Drug Type | small molecule | |
| Molecular Formula | C19H20Br2N6O4S | |
| Molecular Weight | 588.281 | |
| Description | Macitentan is an endothelin receptor antagonist used to manage pulmonary arterial hypertension to delay disease progression. | |
| ATC Classification | C02KX04 | |
| IUPAC Name | {[5-(4-Bromophenyl)-6-{2-[(5-Bromopyrimidin-2-Yl)Oxy]Ethoxy}Pyrimidin-4-Yl]Sulfamoyl}(Propyl)Amine | |
| InChI | Inchi=1S/C19H20Br2N6O4S/C1-2-7-26-32(28,29)27-17-16(13-3-5-14(20)6-4-13)18(25-12-24-17)30-8-9-31-19-22-10-15(21)11-23-19/H3-6,10-12,26H,2,7-9H2,1H3,(H,24,25,27) | |
| InChI Key | JGCMEBMXRHSZKX-UHFFFAOYSA-N | |
| Canonical SMILES | CCCNS(=O)(=O)NC1=C(C(OCCOC2=NC=C(Br)C=N2)=NC=N1)C1=CC=C(Br)C=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Macitentan
| Severity level | ID | Name | Mechanism | Detail |
|---|