Drugs Information: Magnesium carbonate
Basic Information
|
||
| ID | DDInter1113 | |
| Drug Type | small molecule | |
| Molecular Formula | Cmgo3 | |
| Molecular Weight | 84.313 | |
| Description | Magnesium carbonate is an antacid used for symptomatic relief of heartburn, indigestion, and upset stomach. | |
| ATC Classification | A02AA01 V03AE04 A06AD01 | |
| IUPAC Name | Magnesium(2+) Ion Carbonate | |
| InChI | Inchi=1S/Ch2O3.Mg/C2-1(3)4;/H(H2,2,3,4);/Q;+2/P-2 | |
| InChI Key | ZLNQQNXFFQJAID-UHFFFAOYSA-L | |
| Canonical SMILES | [Mg++].[O-]C([O-])=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Magnesium carbonate
| Severity level | ID | Name | Mechanism | Detail |
|---|