Drugs Information: Mefloquine
Basic Information
|
||
| ID | DDInter1140 | |
| Drug Type | small molecule | |
| Molecular Formula | C17H16F6N2O | |
| Molecular Weight | 378.316 | |
| Description | Mefloquine is an antimalarial agent used in the prophylaxis and treatment of malaria caused by Plasmodium falciparum and Plasmodium vivax. | |
| ATC Classification | P01BF02 P01BC02 | |
| IUPAC Name | [2,8-Bis(Trifluoromethyl)Quinolin-4-Yl](Piperidin-2-Yl)Methanol | |
| InChI | Inchi=1S/C17H16F6N2O/C18-16(19,20)11-5-3-4-9-10(15(26)12-6-1-2-7-24-12)8-13(17(21,22)23)25-14(9)11/H3-5,8,12,15,24,26H,1-2,6-7H2 | |
| InChI Key | XEEQGYMUWCZPDN-UHFFFAOYSA-N | |
| Canonical SMILES | OC(C1CCCCN1)C1=CC(=NC2=C1C=CC=C2C(F)(F)F)C(F)(F)F | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Mefloquine
| Severity level | ID | Name | Mechanism | Detail |
|---|