Drugs Information: Memantine
Basic Information
|
||
| ID | DDInter1146 | |
| Drug Type | small molecule | |
| Molecular Formula | C12H21N | |
| Molecular Weight | 179.307 | |
| Description | Memantine is an NMDA receptor antagonist used to treat moderate to severe dementia in Alzheimer's. | |
| ATC Classification | N06DA52 N06DX01 N06DA53 | |
| IUPAC Name | 3,5-Dimethyladamantan-1-Amine | |
| InChI | Inchi=1S/C12H21N/C1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10/H9H,3-8,13H2,1-2H3 | |
| InChI Key | BUGYDGFZZOZRHP-UHFFFAOYSA-N | |
| Canonical SMILES | CC12CC3CC(C)(C1)CC(N)(C3)C2 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Memantine
| Severity level | ID | Name | Mechanism | Detail |
|---|