Drugs Information: Meprobamate
Basic Information
|
||
| ID | DDInter1154 | |
| Drug Type | small molecule | |
| Molecular Formula | C9H18N2O4 | |
| Molecular Weight | 218.253 | |
| Description | Meprobamate is an anxiolytic drug used for the short-term management of anxiety symptoms. | |
| ATC Classification | N05BC51 N05CX01 N05BC01 | |
| IUPAC Name | 2-[(Carbamoyloxy)Methyl]-2-Methylpentyl Carbamate | |
| InChI | Inchi=1S/C9H18N2O4/C1-3-4-9(2,5-14-7(10)12)6-15-8(11)13/H3-6H2,1-2H3,(H2,10,12)(H2,11,13) | |
| InChI Key | NPPQSCRMBWNHMW-UHFFFAOYSA-N | |
| Canonical SMILES | CCCC(C)(COC(N)=O)COC(N)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Meprobamate
| Severity level | ID | Name | Mechanism | Detail |
|---|