Drugs Information: Argatroban
Basic Information
|
||
| ID | DDInter117 | |
| Drug Type | small molecule | |
| Molecular Formula | C23H36N6O5S | |
| Molecular Weight | 508.644 | |
| Description | Argatroban is a synthetic direct thrombin inhibitor used for the prevention and treatment of thrombosis related to heparin use. | |
| ATC Classification | B01AE03 | |
| IUPAC Name | (2R,4R)-1-[(2S)-5-Carbamimidamido-2-(3-Methyl-1,2,3,4-Tetrahydroquinoline-8-Sulfonamido)Pentanoyl]-4-Methylpiperidine-2-Carboxyl | |
| InChI | Inchi=1S/C23H36N6O5S/C1-14-8-10-29(18(12-14)22(31)32)21(30)17(6-4-9-26-23(24)25)28-35(33,34)19-7-3-5-16-11-15(2)13-27-20(16)19/H3,5,7,14-15,17-18,27-28H,4,6,8-13H2,1-2H3,(H,31,32)(H4,24,25,26)/T14-,15?,17+,18-/M1/S1 | |
| InChI Key | KXNPVXPOPUZYGB-IOVMHBDKSA-N | |
| Canonical SMILES | C[C@@H]1CCN([C@H](C1)C(O)=O)C(=O)[C@H](CCCNC(N)=N)NS(=O)(=O)C1=CC=CC2=C1NCC(C)C2 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Argatroban
| Severity level | ID | Name | Mechanism | Detail |
|---|