Drugs Information: Methotrexate
Basic Information
|
|
||
| ID | DDInter1174 | |
| Drug Type | small molecule | |
| Molecular Formula | C20H22N8O5 | |
| Molecular Weight | 454.447 | |
| Description | Methotrexate is an antineoplastic agent used the treatment of a wide variety of cancers as well as severe psoriasis, severe rheumatoid arthritis, and juvenile rheumatoid arthritis. | |
| ATC Classification | L04AX03 L01BA01 | |
| IUPAC Name | (2S)-2-[(4-{[(4-Amino-2-Imino-2,3-Dihydropteridin-6-Yl)Methyl](Methyl)Amino}Phenyl)Formamido]Pentanedioic Acid | |
| InChI | Inchi=1S/C20H22N8O5/C1-28(9-11-8-23-17-15(24-11)16(21)26-20(22)27-17)12-4-2-10(3-5-12)18(31)25-13(19(32)33)6-7-14(29)30/H2-5,8,13H,6-7,9H2,1H3,(H,25,31)(H,29,30)(H,32,33)(H4,21,22,23,26,27)/T13-/M0/S1 | |
| InChI Key | FBOZXECLQNJBKD-ZDUSSCGKSA-N | |
| Canonical SMILES | CN(CC1=CN=C2N=C(N)N=C(N)C2=N1)C1=CC=C(C=C1)C(=O)N[C@@H](CCC(O)=O)C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Methotrexate
| Severity level | ID | Name | Mechanism | Detail |
|---|