Drugs Information: Methyl aminolevulinate (topical)
Basic Information
|
||
| ID | DDInter1182 | |
| Drug Type | small molecule | |
| Molecular Formula | C6H11No3 | |
| Molecular Weight | 145.158 | |
| Description | Methyl aminolevulinate is a porphyrin precursor used to treat non-hyperkeratotic, non-pigmented actinic keratosis of the face and scalp. | |
| ATC Classification | L01XD03 | |
| IUPAC Name | Methyl 5-Amino-4-Oxopentanoate | |
| InChI | Inchi=1S/C6H11No3/C1-10-6(9)3-2-5(8)4-7/H2-4,7H2,1H3 | |
| InChI Key | YUUAYBAIHCDHHD-UHFFFAOYSA-N | |
| Canonical SMILES | COC(=O)CCC(=O)CN | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Methyl aminolevulinate (topical)
| Severity level | ID | Name | Mechanism | Detail |
|---|