Drugs Information: Acebutolol
Basic Information
|
||
| ID | DDInter12 | |
| Drug Type | small molecule | |
| Molecular Formula | C18H28N2O4 | |
| Molecular Weight | 336.432 | |
| Description | Acebutolol is a selective β1-receptor antagonist used for the management of hypertension and ventricular premature beats in adults. | |
| ATC Classification | C07AB04 C07BB04 | |
| IUPAC Name | N-(3-Acetyl-4-{2-Hydroxy-3-[(Propan-2-Yl)Amino]Propoxy}Phenyl)Butanamide | |
| InChI | Inchi=1S/C18H28N2O4/C1-5-6-18(23)20-14-7-8-17(16(9-14)13(4)21)24-11-15(22)10-19-12(2)3/H7-9,12,15,19,22H,5-6,10-11H2,1-4H3,(H,20,23) | |
| InChI Key | GOEMGAFJFRBGGG-UHFFFAOYSA-N | |
| Canonical SMILES | CCCC(=O)NC1=CC=C(OCC(O)CNC(C)C)C(=C1)C(C)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Acebutolol
| Severity level | ID | Name | Mechanism | Detail |
|---|