Drugs Information: Metyrosine
Basic Information
|
||
| ID | DDInter1205 | |
| Drug Type | small molecule | |
| Molecular Formula | C10H13No3 | |
| Molecular Weight | 195.218 | |
| Description | Metyrosine is a tyrosine 3-monooxygenase inhibitor used to treat excessive sympathetic stimulation in pheochromocytoma. | |
| ATC Classification | C02KB01 | |
| IUPAC Name | (2S)-2-Amino-3-(4-Hydroxyphenyl)-2-Methylpropanoic Acid | |
| InChI | Inchi=1S/C10H13No3/C1-10(11,9(13)14)6-7-2-4-8(12)5-3-7/H2-5,12H,6,11H2,1H3,(H,13,14)/T10-/M0/S1 | |
| InChI Key | NHTGHBARYWONDQ-JTQLQIEISA-N | |
| Canonical SMILES | C[C@](N)(CC1=CC=C(O)C=C1)C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Metyrosine
| Severity level | ID | Name | Mechanism | Detail |
|---|