Drugs Information: Mirabegron
Basic Information
|
||
| ID | DDInter1229 | |
| Drug Type | small molecule | |
| Molecular Formula | C21H24N4O2S | |
| Molecular Weight | 396.515 | |
| Description | Mirabegron is a beta-3 adrenergic agonist used to treat overactive bladder and neurogenic detrusor overactivity. | |
| ATC Classification | G04BD12 | |
| IUPAC Name | 2-(2-Amino-1,3-Thiazol-4-Yl)-N-[4-(2-{[(2R)-2-Hydroxy-2-Phenylethyl]Amino}Ethyl)Phenyl]Acetamide | |
| InChI | Inchi=1S/C21H24N4O2S/C22-21-25-18(14-28-21)12-20(27)24-17-8-6-15(7-9-17)10-11-23-13-19(26)16-4-2-1-3-5-16/H1-9,14,19,23,26H,10-13H2,(H2,22,25)(H,24,27)/T19-/M0/S1 | |
| InChI Key | PBAPPPCECJKMCM-IBGZPJMESA-N | |
| Canonical SMILES | NC1=NC(CC(=O)NC2=CC=C(CCNC[C@H](O)C3=CC=CC=C3)C=C2)=CS1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Mirabegron
| Severity level | ID | Name | Mechanism | Detail |
|---|