Drugs Information: Misoprostol
Basic Information
|
||
| ID | DDInter1231 | |
| Drug Type | small molecule | |
| Molecular Formula | C22H38O5 | |
| Molecular Weight | 382.541 | |
| Description | Misoprostol is a prostaglandin E1 analogue used to reduce the risk of NSAID-induced gastric ulcers. | |
| ATC Classification | G02AD06 A02BB01 M01AE56 | |
| IUPAC Name | Methyl 7-[(1R,2R,3R)-3-Hydroxy-2-[(1E)-4-Hydroxy-4-Methyloct-1-En-1-Yl]-5-Oxocyclopentyl]Heptanoate | |
| InChI | Inchi=1S/C22H38O5/C1-4-5-14-22(2,26)15-10-12-18-17(19(23)16-20(18)24)11-8-6-7-9-13-21(25)27-3/H10,12,17-18,20,24,26H,4-9,11,13-16H2,1-3H3/B12-10+/T17-,18-,20-,22?/M1/S1 | |
| InChI Key | OJLOPKGSLYJEMD-URPKTTJQSA-N | |
| Canonical SMILES | CCCCC(C)(O)C\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)OC | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Misoprostol
| Severity level | ID | Name | Mechanism | Detail |
|---|