Drugs Information: Montelukast
Basic Information
|
||
| ID | DDInter1242 | |
| Drug Type | small molecule | |
| Molecular Formula | C35H36Clno3S | |
| Molecular Weight | 586.196 | |
| Description | Montelukast is a leukotriene receptor antagonist used as part of an asthma therapy regimen, to prevent exercise induced bronchoconstriction, and to treat seasonal allergic rhinitis. | |
| ATC Classification | R03DC03 R03DC53 | |
| IUPAC Name | 2-[1-({[(1R)-1-{3-[(E)-2-(7-Chloroquinolin-2-Yl)Ethenyl]Phenyl}-3-[2-(2-Hydroxypropan-2-Yl)Phenyl]Propyl]Sulfanyl}Methyl)Cyclopr | |
| InChI | Inchi=1S/C35H36Clno3S/C1-34(2,40)30-9-4-3-7-25(30)13-17-32(41-23-35(18-19-35)22-33(38)39)27-8-5-6-24(20-27)10-15-29-16-12-26-11-14-28(36)21-31(26)37-29/H3-12,14-16,20-21,32,40H,13,17-19,22-23H2,1-2H3,(H,38,39)/B15-10+/T32-/M1/S1 | |
| InChI Key | UCHDWCPVSPXUMX-TZIWLTJVSA-N | |
| Canonical SMILES | OC(=O)CC1(CC1)CS[C@H](CCC1=CC=CC=C1C(O)(C)C)C1=CC=CC(\C=C\C2=NC3=C(C=CC(Cl)=C3)C=C2)=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Montelukast
| Severity level | ID | Name | Mechanism | Detail |
|---|