Drugs Information: Mupirocin
Basic Information
|
||
| ID | DDInter1249 | |
| Drug Type | small molecule | |
| Molecular Formula | C26H44O9 | |
| Molecular Weight | 500.629 | |
| Description | Mupirocin is an antibacterial ointment used to treat impetigo and secondary skin infections caused by Staphylococcus aureus and Streptococcus pyogenes. | |
| ATC Classification | R01AX06 D06AX09 | |
| IUPAC Name | 9-{[(2E)-4-[(2S,3R,4R,5S)-3,4-Dihydroxy-5-{[(2S,3S)-3-[(2S,3S)-3-Hydroxybutan-2-Yl]Oxiran-2-Yl]Methyl}Oxan-2-Yl]-3-Methylbut-2-E | |
| InChI | Inchi=1S/C26H44O9/C1-16(13-23(30)33-11-9-7-5-4-6-8-10-22(28)29)12-20-25(32)24(31)19(15-34-20)14-21-26(35-21)17(2)18(3)27/H13,17-21,24-27,31-32H,4-12,14-15H2,1-3H3,(H,28,29)/B16-13+/T17-,18-,19-,20-,21-,24+,25-,26-/M0/S1 | |
| InChI Key | MINDHVHHQZYEEK-HBBNESRFSA-N | |
| Canonical SMILES | C[C@H](O)[C@H](C)[C@@H]1O[C@H]1C[C@H]1CO[C@@H](C\C(C)=C\C(=O)OCCCCCCCCC(O)=O)[C@H](O)[C@@H]1O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Mupirocin
| Severity level | ID | Name | Mechanism | Detail |
|---|