Drugs Information: Netilmicin
Basic Information
|
||
| ID | DDInter1283 | |
| Drug Type | small molecule | |
| Molecular Formula | C21H41N5O7 | |
| Molecular Weight | 475.587 | |
| Description | Netilmicin is an aminoglycoside used to treat a wide variety of infections in the body. | |
| ATC Classification | S01AA23 J01GB07 | |
| IUPAC Name | (2R,3R,4R,5R)-2-{[(1S,2S,3R,4S,6R)-4-Amino-3-{[(2S,3R)-3-Amino-6-(Aminomethyl)-3,4-Dihydro-2H-Pyran-2-Yl]Oxy}-6-(Ethylamino)-2-H | |
| InChI | Inchi=1S/C21H41N5O7/C1-4-26-13-7-12(24)16(32-19-11(23)6-5-10(8-22)31-19)14(27)17(13)33-20-15(28)18(25-3)21(2,29)9-30-20/H5,11-20,25-29H,4,6-9,22-24H2,1-3H3/T11-,12+,13-,14+,15-,16-,17+,18-,19-,20-,21+/M1/S1 | |
| InChI Key | CIDUJQMULVCIBT-MQDUPKMGSA-N | |
| Canonical SMILES | CCN[C@@H]1C[C@H](N)[C@@H](O[C@H]2OC(CN)=CC[C@H]2N)[C@H](O)[C@H]1O[C@H]1OC[C@](C)(O)[C@H](NC)[C@H]1O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Netilmicin
| Severity level | ID | Name | Mechanism | Detail |
|---|