Drugs Information: Niacin
Basic Information
|
|
||
| ID | DDInter1286 | |
| Drug Type | small molecule | |
| Molecular Formula | C6H5No2 | |
| Molecular Weight | 123.111 | |
| Description | Niacin is a B vitamin used to treat hypertriglyceridemia and pellagra. | |
| ATC Classification | C10AD02 C10AD52 C10BA01 C04AC01 | |
| IUPAC Name | Pyridine-3-Carboxylic Acid | |
| InChI | Inchi=1S/C6H5No2/C8-6(9)5-2-1-3-7-4-5/H1-4H,(H,8,9) | |
| InChI Key | PVNIIMVLHYAWGP-UHFFFAOYSA-N | |
| Canonical SMILES | OC(=O)C1=CN=CC=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Niacin
| Severity level | ID | Name | Mechanism | Detail |
|---|