Drugs Information: Nicotine
Basic Information
|
||
| ID | DDInter1290 | |
| Drug Type | small molecule | |
| Molecular Formula | C10H14N2 | |
| Molecular Weight | 162.236 | |
| Description | Nicotine is a stimulatory alkaloid found in tobacco products that is often used for the relief of nicotine withdrawal symptoms and as an aid to smoking cessation. | |
| ATC Classification | N07BA01 | |
| IUPAC Name | 3-[(2S)-1-Methylpyrrolidin-2-Yl]Pyridine | |
| InChI | Inchi=1S/C10H14N2/C1-12-7-3-5-10(12)9-4-2-6-11-8-9/H2,4,6,8,10H,3,5,7H2,1H3/T10-/M0/S1 | |
| InChI Key | SNICXCGAKADSCV-JTQLQIEISA-N | |
| Canonical SMILES | CN1CCC[C@H]1C1=CN=CC=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Nicotine
| Severity level | ID | Name | Mechanism | Detail |
|---|