Drugs Information: Niraparib
Basic Information
|
||
| ID | DDInter1297 | |
| Drug Type | small molecule | |
| Molecular Formula | C19H20N4O | |
| Molecular Weight | 320.396 | |
| Description | Niraparib is a poly-ADP ribose polymerase inhibitor used to treat recurrent epithelial ovarian, fallopian tube, or primary peritoneal cancer responding to platinum based chemotherapy. | |
| ATC Classification | L01XX54 | |
| IUPAC Name | 2-{4-[(3S)-Piperidin-3-Yl]Phenyl}-2H-Indazole-7-Carboxamide | |
| InChI | Inchi=1S/C19H20N4O/C20-19(24)17-5-1-3-15-12-23(22-18(15)17)16-8-6-13(7-9-16)14-4-2-10-21-11-14/H1,3,5-9,12,14,21H,2,4,10-11H2,(H2,20,24)/T14-/M1/S1 | |
| InChI Key | PCHKPVIQAHNQLW-CQSZACIVSA-N | |
| Canonical SMILES | NC(=O)C1=CC=CC2=CN(N=C12)C1=CC=C(C=C1)[C@@H]1CCCNC1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Niraparib
| Severity level | ID | Name | Mechanism | Detail |
|---|