Drugs Information: Obeticholic acid
Basic Information
|
||
| ID | DDInter1319 | |
| Drug Type | small molecule | |
| Molecular Formula | C26H44O4 | |
| Molecular Weight | 420.634 | |
| Description | Obeticholic acid is a bile acid analog and farnesoid X receptor agonist used to treat primary biliary cholangitis in adult patients with inadequate clinical response or intolerance to UDCA. | |
| ATC Classification | A05AA04 | |
| IUPAC Name | (4R)-4-[(1R,3As,3Bs,4R,5R,5As,7R,9As,9Bs,11Ar)-5-Ethyl-4,7-Dihydroxy-9A,11A-Dimethyl-Hexadecahydro-1H-Cyclopenta[A]Phenanthren-1 | |
| InChI | Inchi=1S/C26H44O4/C1-5-17-21-14-16(27)10-12-26(21,4)20-11-13-25(3)18(15(2)6-9-22(28)29)7-8-19(25)23(20)24(17)30/H15-21,23-24,27,30H,5-14H2,1-4H3,(H,28,29)/T15-,16-,17-,18-,19+,20+,21+,23+,24-,25-,26-/M1/S1 | |
| InChI Key | ZXERDUOLZKYMJM-ZWECCWDJSA-N | |
| Canonical SMILES | [H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)[C@H](CC)[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CCC(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Obeticholic acid
| Severity level | ID | Name | Mechanism | Detail |
|---|