Drugs Information: Olmesartan
Basic Information
|
||
| ID | DDInter1330 | |
| Drug Type | small molecule | |
| Molecular Formula | C24H26N6O3 | |
| Molecular Weight | 446.511 | |
| Description | Olmesartan is an angiotensin receptor blocker (ARB) used in the treatment of hypertension. | |
| ATC Classification | C09DA08 C09DX03 C09CA08 C09DB02 | |
| IUPAC Name | 4-(2-Hydroxypropan-2-Yl)-2-Propyl-1-({4-[2-(1H-1,2,3,4-Tetrazol-5-Yl)Phenyl]Phenyl}Methyl)-1H-Imidazole-5-Carboxylic Acid | |
| InChI | Inchi=1S/C24H26N6O3/C1-4-7-19-25-21(24(2,3)33)20(23(31)32)30(19)14-15-10-12-16(13-11-15)17-8-5-6-9-18(17)22-26-28-29-27-22/H5-6,8-13,33H,4,7,14H2,1-3H3,(H,31,32)(H,26,27,28,29) | |
| InChI Key | VTRAEEWXHOVJFV-UHFFFAOYSA-N | |
| Canonical SMILES | CCCC1=NC(=C(N1CC1=CC=C(C=C1)C1=C(C=CC=C1)C1=NN=NN1)C(O)=O)C(C)(C)O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Olmesartan
| Severity level | ID | Name | Mechanism | Detail |
|---|