Drugs Information: Ombitasvir
Basic Information
|
||
| ID | DDInter1338 | |
| Drug Type | small molecule | |
| Molecular Formula | C50H67N7O8 | |
| Molecular Weight | - | |
| Description | Ombitasvir is a direct acting antiviral agent used in combination with other antiviral agents for the treatment of Hepatitis C Virus (HCV) infections. | |
| ATC Classification | J05AP53 J05AP52 | |
| IUPAC Name | Methyl N-[(2S)-1-[(2S)-2-({4-[(2S,5S)-1-(4-Tert-Butylphenyl)-5-{4-[(2S)-1-[(2S)-2-[(Methoxycarbonyl)Amino]-3-Methylbutanoyl]Pyrr | |
| InChI | Inchi=1S/C50H67N7O8/C1-30(2)42(53-48(62)64-8)46(60)55-28-10-12-40(55)44(58)51-35-20-14-32(15-21-35)38-26-27-39(57(38)37-24-18-34(19-25-37)50(5,6)7)33-16-22-36(23-17-33)52-45(59)41-13-11-29-56(41)47(61)43(31(3)4)54-49(63)65-9/H14-25,30-31,38-43H,10-13,26-29H2,1-9H3,(H,51,58)(H,52,59)(H,53,62)(H,54,63)/T38-,39-,40-,41-,42-,43-/M0/S1 | |
| InChI Key | PIDFDZJZLOTZTM-KHVQSSSXSA-N | |
| Canonical SMILES | COC(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@H]1C(=O)NC1=CC=C(C=C1)[C@@H]1CC[C@H](N1C1=CC=C(C=C1)C(C)(C)C)C1=CC=C(NC(=O)[C@@H]2CCCN2C(=O)[C@@H](NC(=O)OC)C(C)C)C=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Ombitasvir
| Severity level | ID | Name | Mechanism | Detail |
|---|