Drugs Information: Oxitriptan
Basic Information
|
||
| ID | DDInter1362 | |
| Drug Type | small molecule | |
| Molecular Formula | C11H12N2O3 | |
| Molecular Weight | 220.228 | |
| Description | Oxitriptan is a naturally occurring amino acid that is used to manage post-hypoxic myoclonus. | |
| ATC Classification | N06AX01 | |
| IUPAC Name | (2S)-2-Amino-3-(5-Hydroxy-1H-Indol-3-Yl)Propanoic Acid | |
| InChI | Inchi=1S/C11H12N2O3/C12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10/H1-2,4-5,9,13-14H,3,12H2,(H,15,16)/T9-/M0/S1 | |
| InChI Key | LDCYZAJDBXYCGN-VIFPVBQESA-N | |
| Canonical SMILES | N[C@@H](CC1=CNC2=C1C=C(O)C=C2)C(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Oxitriptan
| Severity level | ID | Name | Mechanism | Detail |
|---|