Drugs Information: Oxybutynin
Basic Information
|
||
| ID | DDInter1365 | |
| Drug Type | small molecule | |
| Molecular Formula | C22H31No3 | |
| Molecular Weight | 357.494 | |
| Description | Oxybutynin is an antimuscarinic agent that reduces detrusor muscle activity, relaxing the bladder and preventing the urge to void. | |
| ATC Classification | G04BD04 | |
| IUPAC Name | 4-(Diethylamino)But-2-Yn-1-Yl 2-Cyclohexyl-2-Hydroxy-2-Phenylacetate | |
| InChI | Inchi=1S/C22H31No3/C1-3-23(4-2)17-11-12-18-26-21(24)22(25,19-13-7-5-8-14-19)20-15-9-6-10-16-20/H5,7-8,13-14,20,25H,3-4,6,9-10,15-18H2,1-2H3 | |
| InChI Key | XIQVNETUBQGFHX-UHFFFAOYSA-N | |
| Canonical SMILES | CCN(CC)CC#CCOC(=O)C(O)(C1CCCCC1)C1=CC=CC=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Oxybutynin
| Severity level | ID | Name | Mechanism | Detail |
|---|