Drugs Information: Oxyquinoline (topical)
Basic Information
|
||
| ID | DDInter1373 | |
| Drug Type | small molecule | |
| Molecular Formula | C9H7No | |
| Molecular Weight | 145.161 | |
| Description | Oxyquinoline is a medication used in combination with other medications to restore vaginal pH. | |
| ATC Classification | R02AA14 A01AB07 D08AH03 G01AC30 | |
| IUPAC Name | Quinolin-8-Ol | |
| InChI | Inchi=1S/C9H7No/C11-8-5-1-3-7-4-2-6-10-9(7)8/H1-6,11H | |
| InChI Key | MCJGNVYPOGVAJF-UHFFFAOYSA-N | |
| Canonical SMILES | OC1=CC=CC2=C1N=CC=C2 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Oxyquinoline (topical)
| Severity level | ID | Name | Mechanism | Detail |
|---|