Drugs Information: Pamidronic acid
Basic Information
|
||
| ID | DDInter1383 | |
| Drug Type | small molecule | |
| Molecular Formula | C3H11No7P2 | |
| Molecular Weight | 235.069 | |
| Description | Pamidronic acid is a bisphosphonate used to treat Paget's disease, to treat hypercalcemia of malignancy, and to treat osteolytic bone lesions. | |
| ATC Classification | M05BA03 | |
| IUPAC Name | (3-Amino-1-Hydroxy-1-Phosphonopropyl)Phosphonic Acid | |
| InChI | Inchi=1S/C3H11No7P2/C4-2-1-3(5,12(6,7)8)13(9,10)11/H5H,1-2,4H2,(H2,6,7,8)(H2,9,10,11) | |
| InChI Key | WRUUGTRCQOWXEG-UHFFFAOYSA-N | |
| Canonical SMILES | NCCC(O)(P(O)(O)=O)P(O)(O)=O | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Pamidronic acid
| Severity level | ID | Name | Mechanism | Detail |
|---|