Drugs Information: Panobinostat
Basic Information
|
||
| ID | DDInter1387 | |
| Drug Type | small molecule | |
| Molecular Formula | C21H23N3O2 | |
| Molecular Weight | 349.434 | |
| Description | Panobinostat is a non-selective histone deacetylase inhibitor used to treat multiple myeloma in combination with other antineoplastic agents. | |
| ATC Classification | L01XX42 | |
| IUPAC Name | (2E)-N-Hydroxy-3-[4-({[2-(2-Methyl-1H-Indol-3-Yl)Ethyl]Amino}Methyl)Phenyl]Prop-2-Enamide | |
| InChI | Inchi=1S/C21H23N3O2/C1-15-18(19-4-2-3-5-20(19)23-15)12-13-22-14-17-8-6-16(7-9-17)10-11-21(25)24-26/H2-11,22-23,26H,12-14H2,1H3,(H,24,25)/B11-10+ | |
| InChI Key | FPOHNWQLNRZRFC-ZHACJKMWSA-N | |
| Canonical SMILES | CC1=C(CCNCC2=CC=C(\C=C\C(=O)NO)C=C2)C2=CC=CC=C2N1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Panobinostat
| Severity level | ID | Name | Mechanism | Detail |
|---|