Drugs Information: Paritaprevir
Basic Information
|
|
||
| ID | DDInter1395 | |
| Drug Type | small molecule | |
| Molecular Formula | C40H43N7O7S | |
| Molecular Weight | 765.892 | |
| Description | Paritaprevir is a direct acting antiviral agent used in combination with other antiviral agents for the treatment of Hepatitis C Virus (HCV) infections. | |
| ATC Classification | J05AP53 J05AP52 | |
| IUPAC Name | (1S,4R,6S,7Z,14S,18R)-N-(Cyclopropanesulfonyl)-14-(5-Methylpyrazine-2-Amido)-2,15-Dioxo-18-(Phenanthridin-6-Yloxy)-3,16-Diazatri | |
| InChI | Inchi=1S/C40H43N7O7S/C1-24-21-42-33(22-41-24)35(48)43-32-16-6-4-2-3-5-11-25-20-40(25,39(51)46-55(52,53)27-17-18-27)45-36(49)34-19-26(23-47(34)38(32)50)54-37-30-14-8-7-12-28(30)29-13-9-10-15-31(29)44-37/H5,7-15,21-22,25-27,32,34H,2-4,6,16-20,23H2,1H3,(H,43,48)(H,45,49)(H,46,51)/B11-5-/T25-,26-,32+,34+,40-/M1/S1 | |
| InChI Key | UAUIUKWPKRJZJV-QPLHLKROSA-N | |
| Canonical SMILES | [H][C@@]12C[C@]1(NC(=O)[C@]1([H])C[C@H](CN1C(=O)[C@H](CCCCC\C=C/2)NC(=O)C1=CN=C(C)C=N1)OC1=NC2=C(C=CC=C2)C2=C1C=CC=C2)C(=O)NS(=O)(=O)C1CC1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Paritaprevir
| Severity level | ID | Name | Mechanism | Detail |
|---|