Drugs Information: Pazopanib
Basic Information
|
||
| ID | DDInter1400 | |
| Drug Type | small molecule | |
| Molecular Formula | C21H23N7O2S | |
| Molecular Weight | 437.528 | |
| Description | Pazopanib is an antineoplastic agent used in the treatment of advanced renal cell cancer and advanced soft tissue sarcoma in patients with prior chemotherapy. | |
| ATC Classification | L01XE11 | |
| IUPAC Name | 5-({4-[(2,3-Dimethyl-2H-Indazol-6-Yl)(Methyl)Amino]Pyrimidin-2-Yl}Amino)-2-Methylbenzene-1-Sulfonamide | |
| InChI | Inchi=1S/C21H23N7O2S/C1-13-5-6-15(11-19(13)31(22,29)30)24-21-23-10-9-20(25-21)27(3)16-7-8-17-14(2)28(4)26-18(17)12-16/H5-12H,1-4H3,(H2,22,29,30)(H,23,24,25) | |
| InChI Key | CUIHSIWYWATEQL-UHFFFAOYSA-N | |
| Canonical SMILES | CN(C1=CC2=NN(C)C(C)=C2C=C1)C1=CC=NC(NC2=CC=C(C)C(=C2)S(N)(=O)=O)=N1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Pazopanib
| Severity level | ID | Name | Mechanism | Detail |
|---|