Drugs Information: Pegaptanib (ophthalmic)
Basic Information
|
||
| ID | DDInter1403 | |
| Drug Type | biotech | |
| Molecular Formula | C294H342F13N107Na28O188P28[C2H4O]2N | |
| Molecular Weight | - | |
| Description | Pegaptanib is a selective vascular endothelial growth factor (VEGF) antagonist used for the treatment of neovascular (wet) age-related macular degeneration. | |
| ATC Classification | S01LA03 | |
| IUPAC Name | None | |
| InChI | None | |
| InChI Key | None | |
| Canonical SMILES | None | |
| Useful Links | DrugBank | |
Interactions with Pegaptanib (ophthalmic)
| Severity level | ID | Name | Mechanism | Detail |
|---|