Drugs Information: Penbutolol
Basic Information
|
|
||
| ID | DDInter1417 | |
| Drug Type | small molecule | |
| Molecular Formula | C18H29No2 | |
| Molecular Weight | 291.435 | |
| Description | Penbutolol is a beta-adrenergic antagonist used for the management of mild to moderate arterial hypertension, alone or in combination with other antihypertensive agents. | |
| ATC Classification | C07CA23 C07AA23 | |
| IUPAC Name | (2S)-1-(Tert-Butylamino)-3-(2-Cyclopentylphenoxy)Propan-2-Ol | |
| InChI | Inchi=1S/C18H29No2/C1-18(2,3)19-12-15(20)13-21-17-11-7-6-10-16(17)14-8-4-5-9-14/H6-7,10-11,14-15,19-20H,4-5,8-9,12-13H2,1-3H3/T15-/M0/S1 | |
| InChI Key | KQXKVJAGOJTNJS-HNNXBMFYSA-N | |
| Canonical SMILES | CC(C)(C)NC[C@H](O)COC1=CC=CC=C1C1CCCC1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Penbutolol
| Severity level | ID | Name | Mechanism | Detail |
|---|