Drugs Information: Pentamidine
Basic Information
|
||
| ID | DDInter1420 | |
| Drug Type | small molecule | |
| Molecular Formula | C19H24N4O2 | |
| Molecular Weight | 340.427 | |
| Description | Pentamidine is an antifungal agent used to treat Pneumocystis pneumonia in patients infected with HIV. | |
| ATC Classification | P01CX01 | |
| IUPAC Name | 4-{[5-(4-Carbamimidoylphenoxy)Pentyl]Oxy}Benzene-1-Carboximidamide | |
| InChI | Inchi=1S/C19H24N4O2/C20-18(21)14-4-8-16(9-5-14)24-12-2-1-3-13-25-17-10-6-15(7-11-17)19(22)23/H4-11H,1-3,12-13H2,(H3,20,21)(H3,22,23) | |
| InChI Key | XDRYMKDFEDOLFX-UHFFFAOYSA-N | |
| Canonical SMILES | NC(=N)C1=CC=C(OCCCCCOC2=CC=C(C=C2)C(N)=N)C=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Pentamidine
| Severity level | ID | Name | Mechanism | Detail |
|---|