Drugs Information: Pexidartinib
Basic Information
|
||
| ID | DDInter1435 | |
| Drug Type | small molecule | |
| Molecular Formula | C20H15Clf3N5 | |
| Molecular Weight | 417.822 | |
| Description | Pexidartinib is an antitumor agent that is used for the treatment of rare disease tenosynovial giant cell tumors (TGCT) by inhibiting colony-stimulating factor 1 and its receptor. | |
| ATC Classification | - | |
| IUPAC Name | 5-({5-Chloro-1H-Pyrrolo[2,3-B]Pyridin-3-Yl}Methyl)-N-{[6-(Trifluoromethyl)Pyridin-3-Yl]Methyl}Pyridin-2-Amine | |
| InChI | Inchi=1S/C20H15Clf3N5/C21-15-6-16-14(10-28-19(16)29-11-15)5-12-2-4-18(26-7-12)27-9-13-1-3-17(25-8-13)20(22,23)24/H1-4,6-8,10-11H,5,9H2,(H,26,27)(H,28,29) | |
| InChI Key | JGWRKYUXBBNENE-UHFFFAOYSA-N | |
| Canonical SMILES | FC(F)(F)C1=CC=C(CNC2=NC=C(CC3=CNC4=NC=C(Cl)C=C34)C=C2)C=N1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Pexidartinib
| Severity level | ID | Name | Mechanism | Detail |
|---|