Drugs Information: Phenacemide
Basic Information
|
||
| ID | DDInter1437 | |
| Drug Type | small molecule | |
| Molecular Formula | C9H10N2O2 | |
| Molecular Weight | 178.191 | |
| Description | Phenacemide is used to control certain seizures in the treatment of epilepsy. This medicine acts on the central nervous system (CNS) to reduce the number and severity of seizures. | |
| ATC Classification | N03AX07 | |
| IUPAC Name | (2-Phenylacetyl)Urea | |
| InChI | Inchi=1S/C9H10N2O2/C10-9(13)11-8(12)6-7-4-2-1-3-5-7/H1-5H,6H2,(H3,10,11,12,13) | |
| InChI Key | XPFRXWCVYUEORT-UHFFFAOYSA-N | |
| Canonical SMILES | NC(=O)NC(=O)CC1=CC=CC=C1 | |
| Useful Links | DrugBank ChEMBL PubChem | |
Interactions with Phenacemide
| Severity level | ID | Name | Mechanism | Detail |
|---|